C12H16N4 — CID 82816961
3-amino-2-[cyclopropyl(propyl)amino]pyridine-4-carbonitrile (PubChem CID 82816961) has the molecular formula C12H16N4 and a molecular weight of 216.29 g/mol. Its IUPAC name is 3-amino-2-[cyclopropyl(propyl)amino]pyridine-4-carbonitrile.
| Compound Name | 3-amino-2-[cyclopropyl(propyl)amino]pyridine-4-carbonitrile |
|---|---|
| PubChem CID | 82816961 |
| Molecular Formula | C12H16N4 |
| Molecular Weight | 216.29 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | 3-amino-2-[cyclopropyl(propyl)amino]pyridine-4-carbonitrile |
| SMILES | CCCN(c1nccc(C#N)c1N)C1CC1 |
| InChI | InChI=1S/C12H16N4/c1-2-7-16(10-3-4-10)12-11(14)9(8-13)5-6-15-12/h5-6,10H,2-4,7,14H2,1H3 |
| InChIKey | KMVWWUMZNORTMF-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 65.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.29 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |