C12H13N5 — CID 82817619
3-amino-2-[2-cyanoethyl(cyclopropyl)amino]pyridine-4-carbonitrile (PubChem CID 82817619) has the molecular formula C12H13N5 and a molecular weight of 227.27 g/mol. Its IUPAC name is 3-amino-2-[2-cyanoethyl(cyclopropyl)amino]pyridine-4-carbonitrile.
| Compound Name | 3-amino-2-[2-cyanoethyl(cyclopropyl)amino]pyridine-4-carbonitrile |
|---|---|
| PubChem CID | 82817619 |
| Molecular Formula | C12H13N5 |
| Molecular Weight | 227.27 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | 3-amino-2-[2-cyanoethyl(cyclopropyl)amino]pyridine-4-carbonitrile |
| SMILES | N#CCCN(c1nccc(C#N)c1N)C1CC1 |
| InChI | InChI=1S/C12H13N5/c13-5-1-7-17(10-2-3-10)12-11(15)9(8-14)4-6-16-12/h4,6,10H,1-3,7,15H2 |
| InChIKey | VAABMLPJLYWZOH-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 89.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.27 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |