C12H13Cl3N2 — CID 102751245
3,5,6-trichloro-N-cyclopropyl-N-(cyclopropylmethyl)pyridin-2-amine (PubChem CID 102751245) has the molecular formula C12H13Cl3N2 and a molecular weight of 291.61 g/mol. Its IUPAC name is 3,5,6-trichloro-N-cyclopropyl-N-(cyclopropylmethyl)pyridin-2-amine.
| Compound Name | 3,5,6-trichloro-N-cyclopropyl-N-(cyclopropylmethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 102751245 |
| Molecular Formula | C12H13Cl3N2 |
| Molecular Weight | 291.61 g/mol |
| Exact Mass | 290.01 |
| IUPAC Name | 3,5,6-trichloro-N-cyclopropyl-N-(cyclopropylmethyl)pyridin-2-amine |
| SMILES | Clc1cc(Cl)c(N(CC2CC2)C2CC2)nc1Cl |
| InChI | InChI=1S/C12H13Cl3N2/c13-9-5-10(14)12(16-11(9)15)17(8-3-4-8)6-7-1-2-7/h5,7-8H,1-4,6H2 |
| InChIKey | SDVYTEUFHYTNKW-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.61 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|