C10H14ClN3O — CID 115554562
2-(4-amino-5-chloro-N,2-dimethylanilino)acetamide (PubChem CID 115554562) has the molecular formula C10H14ClN3O and a molecular weight of 227.69 g/mol. Its IUPAC name is 2-(4-amino-5-chloro-N,2-dimethylanilino)acetamide.
| Compound Name | 2-(4-amino-5-chloro-N,2-dimethylanilino)acetamide |
|---|---|
| PubChem CID | 115554562 |
| Molecular Formula | C10H14ClN3O |
| Molecular Weight | 227.69 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | 2-(4-amino-5-chloro-N,2-dimethylanilino)acetamide |
| SMILES | Cc1cc(N)c(Cl)cc1N(C)CC(N)=O |
| InChI | InChI=1S/C10H14ClN3O/c1-6-3-8(12)7(11)4-9(6)14(2)5-10(13)15/h3-4H,5,12H2,1-2H3,(H2,13,15) |
| InChIKey | NVWJHLKKTNDFSX-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 72.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.69 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|