C14H20ClN3O2 — CID 115556122
N-[2-(aminomethyl)cyclopentyl]-5-chloro-N,2-dimethyl-4-nitroaniline (PubChem CID 115556122) has the molecular formula C14H20ClN3O2 and a molecular weight of 297.79 g/mol. Its IUPAC name is N-[2-(aminomethyl)cyclopentyl]-5-chloro-N,2-dimethyl-4-nitroaniline.
| Compound Name | N-[2-(aminomethyl)cyclopentyl]-5-chloro-N,2-dimethyl-4-nitroaniline |
|---|---|
| PubChem CID | 115556122 |
| Molecular Formula | C14H20ClN3O2 |
| Molecular Weight | 297.79 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | N-[2-(aminomethyl)cyclopentyl]-5-chloro-N,2-dimethyl-4-nitroaniline |
| SMILES | Cc1cc([N+](=O)[O-])c(Cl)cc1N(C)C1CCCC1CN |
| InChI | InChI=1S/C14H20ClN3O2/c1-9-6-14(18(19)20)11(15)7-13(9)17(2)12-5-3-4-10(12)8-16/h6-7,10,12H,3-5,8,16H2,1-2H3 |
| InChIKey | WCJGKDLNAPCISP-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 72.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.79 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|