C13H18IN3O2 — CID 106493484
N-[2-(aminomethyl)cyclopentyl]-3-iodo-N-methyl-4-nitroaniline (PubChem CID 106493484) has the molecular formula C13H18IN3O2 and a molecular weight of 375.21 g/mol. Its IUPAC name is N-[2-(aminomethyl)cyclopentyl]-3-iodo-N-methyl-4-nitroaniline.
| Compound Name | N-[2-(aminomethyl)cyclopentyl]-3-iodo-N-methyl-4-nitroaniline |
|---|---|
| PubChem CID | 106493484 |
| Molecular Formula | C13H18IN3O2 |
| Molecular Weight | 375.21 g/mol |
| Exact Mass | 375.04 |
| IUPAC Name | N-[2-(aminomethyl)cyclopentyl]-3-iodo-N-methyl-4-nitroaniline |
| SMILES | CN(c1ccc([N+](=O)[O-])c(I)c1)C1CCCC1CN |
| InChI | InChI=1S/C13H18IN3O2/c1-16(12-4-2-3-9(12)8-15)10-5-6-13(17(18)19)11(14)7-10/h5-7,9,12H,2-4,8,15H2,1H3 |
| InChIKey | CTNVQBSXPCXBIZ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 72.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.21 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|