C12H17BrN4O2 — CID 79524147
N-[2-(aminomethyl)cyclopentyl]-3-bromo-N-methyl-5-nitropyridin-2-amine (PubChem CID 79524147) has the molecular formula C12H17BrN4O2 and a molecular weight of 329.20 g/mol. Its IUPAC name is N-[2-(aminomethyl)cyclopentyl]-3-bromo-N-methyl-5-nitropyridin-2-amine.
| Compound Name | N-[2-(aminomethyl)cyclopentyl]-3-bromo-N-methyl-5-nitropyridin-2-amine |
|---|---|
| PubChem CID | 79524147 |
| Molecular Formula | C12H17BrN4O2 |
| Molecular Weight | 329.20 g/mol |
| Exact Mass | 328.05 |
| IUPAC Name | N-[2-(aminomethyl)cyclopentyl]-3-bromo-N-methyl-5-nitropyridin-2-amine |
| SMILES | CN(c1ncc([N+](=O)[O-])cc1Br)C1CCCC1CN |
| InChI | InChI=1S/C12H17BrN4O2/c1-16(11-4-2-3-8(11)6-14)12-10(13)5-9(7-15-12)17(18)19/h5,7-8,11H,2-4,6,14H2,1H3 |
| InChIKey | JIAGMQIGWJRAMZ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 85.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.20 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|