C12H15ClN2O4 — CID 115556257
methyl 3-(5-chloro-N,2-dimethyl-4-nitroanilino)propanoate (PubChem CID 115556257) has the molecular formula C12H15ClN2O4 and a molecular weight of 286.72 g/mol. Its IUPAC name is methyl 3-(5-chloro-N,2-dimethyl-4-nitroanilino)propanoate.
| Compound Name | methyl 3-(5-chloro-N,2-dimethyl-4-nitroanilino)propanoate |
|---|---|
| PubChem CID | 115556257 |
| Molecular Formula | C12H15ClN2O4 |
| Molecular Weight | 286.72 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | methyl 3-(5-chloro-N,2-dimethyl-4-nitroanilino)propanoate |
| SMILES | COC(=O)CCN(C)c1cc(Cl)c([N+](=O)[O-])cc1C |
| InChI | InChI=1S/C12H15ClN2O4/c1-8-6-11(15(17)18)9(13)7-10(8)14(2)5-4-12(16)19-3/h6-7H,4-5H2,1-3H3 |
| InChIKey | SPKJZLSUYMSCKG-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.72 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|