C15H20FN3 — CID 115560114
3-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-ylmethyl)-5-fluorobenzenecarboximidamide (PubChem CID 115560114) has the molecular formula C15H20FN3 and a molecular weight of 261.34 g/mol. Its IUPAC name is 3-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-ylmethyl)-5-fluorobenzenecarboximidamide.
| Compound Name | 3-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-ylmethyl)-5-fluorobenzenecarboximidamide |
|---|---|
| PubChem CID | 115560114 |
| Molecular Formula | C15H20FN3 |
| Molecular Weight | 261.34 g/mol |
| Exact Mass | 261.16 |
| IUPAC Name | 3-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-ylmethyl)-5-fluorobenzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cc(F)cc(CN2CC3CCCC3C2)c1 |
| InChI | InChI=1S/C15H20FN3/c16-14-5-10(4-13(6-14)15(17)18)7-19-8-11-2-1-3-12(11)9-19/h4-6,11-12H,1-3,7-9H2,(H3,17,18) |
| InChIKey | STSUSJHYRNEANS-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.34 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|