C13H17F2N3 — CID 105403809
1-[(3,5-difluorophenyl)methyl]piperidine-4-carboximidamide (PubChem CID 105403809) has the molecular formula C13H17F2N3 and a molecular weight of 253.30 g/mol. Its IUPAC name is 1-[(3,5-difluorophenyl)methyl]piperidine-4-carboximidamide.
| Compound Name | 1-[(3,5-difluorophenyl)methyl]piperidine-4-carboximidamide |
|---|---|
| PubChem CID | 105403809 |
| Molecular Formula | C13H17F2N3 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.14 |
| IUPAC Name | 1-[(3,5-difluorophenyl)methyl]piperidine-4-carboximidamide |
| SMILES | [H]/N=C(\N)C1CCN(Cc2cc(F)cc(F)c2)CC1 |
| InChI | InChI=1S/C13H17F2N3/c14-11-5-9(6-12(15)7-11)8-18-3-1-10(2-4-18)13(16)17/h5-7,10H,1-4,8H2,(H3,16,17) |
| InChIKey | RRHIQVPHRZJEND-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|