C13H26N2 — CID 115562266
3-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-N,2-dimethylbutan-1-amine (PubChem CID 115562266) has the molecular formula C13H26N2 and a molecular weight of 210.37 g/mol. Its IUPAC name is 3-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-N,2-dimethylbutan-1-amine.
| Compound Name | 3-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-N,2-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 115562266 |
| Molecular Formula | C13H26N2 |
| Molecular Weight | 210.37 g/mol |
| Exact Mass | 210.21 |
| IUPAC Name | 3-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-N,2-dimethylbutan-1-amine |
| SMILES | CNCC(C)C(C)N1CC2CCCC2C1 |
| InChI | InChI=1S/C13H26N2/c1-10(7-14-3)11(2)15-8-12-5-4-6-13(12)9-15/h10-14H,4-9H2,1-3H3 |
| InChIKey | FAELUFAPDWVAQN-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.37 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |