C34H55BrO4 — CID 11556253
4-bromobutyl (4aS,6aS,6bR,10R,11R,12aR)-10,11-dihydroxy-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylate (PubChem CID 11556253) has the molecular formula C34H55BrO4 and a molecular weight of 607.71 g/mol. Its IUPAC name is 4-bromobutyl (4aS,6aS,6bR,10R,11R,12aR)-10,11-dihydroxy-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylate.
| Compound Name | 4-bromobutyl (4aS,6aS,6bR,10R,11R,12aR)-10,11-dihydroxy-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylate |
|---|---|
| PubChem CID | 11556253 |
| Molecular Formula | C34H55BrO4 |
| Molecular Weight | 607.71 g/mol |
| Exact Mass | 606.33 |
| IUPAC Name | 4-bromobutyl (4aS,6aS,6bR,10R,11R,12aR)-10,11-dihydroxy-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylate |
| SMILES | CC1(C)CC[C@]2(C(=O)OCCCCBr)CC[C@]3(C)C(=CCC4[C@@]5(C)C[C@@H](O)[C@H](O)C(C)(C)C5CC[C@]43C)C2C1 |
| InChI | InChI=1S/C34H55BrO4/c1-29(2)14-16-34(28(38)39-19-9-8-18-35)17-15-32(6)22(23(34)20-29)10-11-26-31(5)21-24(36)27(37)30(3,4)25(31)12-13-33(26,32)7/h10,23-27,36-37H,8-9,11-21H2,1-7H3/t23?,24-,25?,26?,27+,31+,32-,33-,34+/m1/s1 |
| InChIKey | UOZGHCIJZMDPFA-UHZSFPONSA-N |
| XLogP | 7.84 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.71 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|