C14H10F5NO — CID 115564206
N-(2,3,4,5,6-pentafluorophenyl)-4,5,6,7-tetrahydro-1-benzofuran-4-amine (PubChem CID 115564206) has the molecular formula C14H10F5NO and a molecular weight of 303.23 g/mol. Its IUPAC name is N-(2,3,4,5,6-pentafluorophenyl)-4,5,6,7-tetrahydro-1-benzofuran-4-amine.
| Compound Name | N-(2,3,4,5,6-pentafluorophenyl)-4,5,6,7-tetrahydro-1-benzofuran-4-amine |
|---|---|
| PubChem CID | 115564206 |
| Molecular Formula | C14H10F5NO |
| Molecular Weight | 303.23 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | N-(2,3,4,5,6-pentafluorophenyl)-4,5,6,7-tetrahydro-1-benzofuran-4-amine |
| SMILES | Fc1c(F)c(F)c(NC2CCCc3occc32)c(F)c1F |
| InChI | InChI=1S/C14H10F5NO/c15-9-10(16)12(18)14(13(19)11(9)17)20-7-2-1-3-8-6(7)4-5-21-8/h4-5,7,20H,1-3H2 |
| InChIKey | KXDRUBMYBSHUCW-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.23 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|