C14H15NO2 — CID 113315131
3-(4,5,6,7-tetrahydro-1-benzofuran-4-ylamino)phenol (PubChem CID 113315131) has the molecular formula C14H15NO2 and a molecular weight of 229.28 g/mol. Its IUPAC name is 3-(4,5,6,7-tetrahydro-1-benzofuran-4-ylamino)phenol.
| Compound Name | 3-(4,5,6,7-tetrahydro-1-benzofuran-4-ylamino)phenol |
|---|---|
| PubChem CID | 113315131 |
| Molecular Formula | C14H15NO2 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | 3-(4,5,6,7-tetrahydro-1-benzofuran-4-ylamino)phenol |
| SMILES | Oc1cccc(NC2CCCc3occc32)c1 |
| InChI | InChI=1S/C14H15NO2/c16-11-4-1-3-10(9-11)15-13-5-2-6-14-12(13)7-8-17-14/h1,3-4,7-9,13,15-16H,2,5-6H2 |
| InChIKey | OLJFAUXBKPYSCK-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 45.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |