C14H16N2O3S — CID 115465939
4-(4,5,6,7-tetrahydro-1-benzofuran-4-ylamino)benzenesulfonamide (PubChem CID 115465939) has the molecular formula C14H16N2O3S and a molecular weight of 292.36 g/mol. Its IUPAC name is 4-(4,5,6,7-tetrahydro-1-benzofuran-4-ylamino)benzenesulfonamide.
| Compound Name | 4-(4,5,6,7-tetrahydro-1-benzofuran-4-ylamino)benzenesulfonamide |
|---|---|
| PubChem CID | 115465939 |
| Molecular Formula | C14H16N2O3S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | 4-(4,5,6,7-tetrahydro-1-benzofuran-4-ylamino)benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(NC2CCCc3occc32)cc1 |
| InChI | InChI=1S/C14H16N2O3S/c15-20(17,18)11-6-4-10(5-7-11)16-13-2-1-3-14-12(13)8-9-19-14/h4-9,13,16H,1-3H2,(H2,15,17,18) |
| InChIKey | SGVVTQQDVKNEKV-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 85.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |