C12H5F5N4 — CID 115564675
1-(2,3,4,5,6-pentafluorophenyl)imidazo[4,5-c]pyridin-2-amine (PubChem CID 115564675) has the molecular formula C12H5F5N4 and a molecular weight of 300.19 g/mol. Its IUPAC name is 1-(2,3,4,5,6-pentafluorophenyl)imidazo[4,5-c]pyridin-2-amine.
| Compound Name | 1-(2,3,4,5,6-pentafluorophenyl)imidazo[4,5-c]pyridin-2-amine |
|---|---|
| PubChem CID | 115564675 |
| Molecular Formula | C12H5F5N4 |
| Molecular Weight | 300.19 g/mol |
| Exact Mass | 300.04 |
| IUPAC Name | 1-(2,3,4,5,6-pentafluorophenyl)imidazo[4,5-c]pyridin-2-amine |
| SMILES | Nc1nc2cnccc2n1-c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C12H5F5N4/c13-6-7(14)9(16)11(10(17)8(6)15)21-5-1-2-19-3-4(5)20-12(21)18/h1-3H,(H2,18,20) |
| InChIKey | NGPAWIIUCGDHBW-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.19 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|