C14H12F5NS — CID 115564753
1-[5-(2,3,4,5,6-pentafluorophenyl)thiophen-2-yl]butan-1-amine (PubChem CID 115564753) has the molecular formula C14H12F5NS and a molecular weight of 321.31 g/mol. Its IUPAC name is 1-[5-(2,3,4,5,6-pentafluorophenyl)thiophen-2-yl]butan-1-amine.
| Compound Name | 1-[5-(2,3,4,5,6-pentafluorophenyl)thiophen-2-yl]butan-1-amine |
|---|---|
| PubChem CID | 115564753 |
| Molecular Formula | C14H12F5NS |
| Molecular Weight | 321.31 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | 1-[5-(2,3,4,5,6-pentafluorophenyl)thiophen-2-yl]butan-1-amine |
| SMILES | CCCC(N)c1ccc(-c2c(F)c(F)c(F)c(F)c2F)s1 |
| InChI | InChI=1S/C14H12F5NS/c1-2-3-6(20)7-4-5-8(21-7)9-10(15)12(17)14(19)13(18)11(9)16/h4-6H,2-3,20H2,1H3 |
| InChIKey | KHSNWNPVQUWBHB-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.31 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|