C15H15ClF3NS — CID 43154441
1-[5-[4-chloro-3-(trifluoromethyl)phenyl]thiophen-2-yl]butan-1-amine (PubChem CID 43154441) has the molecular formula C15H15ClF3NS and a molecular weight of 333.81 g/mol. Its IUPAC name is 1-[5-[4-chloro-3-(trifluoromethyl)phenyl]thiophen-2-yl]butan-1-amine.
| Compound Name | 1-[5-[4-chloro-3-(trifluoromethyl)phenyl]thiophen-2-yl]butan-1-amine |
|---|---|
| PubChem CID | 43154441 |
| Molecular Formula | C15H15ClF3NS |
| Molecular Weight | 333.81 g/mol |
| Exact Mass | 333.06 |
| IUPAC Name | 1-[5-[4-chloro-3-(trifluoromethyl)phenyl]thiophen-2-yl]butan-1-amine |
| SMILES | CCCC(N)c1ccc(-c2ccc(Cl)c(C(F)(F)F)c2)s1 |
| InChI | InChI=1S/C15H15ClF3NS/c1-2-3-12(20)14-7-6-13(21-14)9-4-5-11(16)10(8-9)15(17,18)19/h4-8,12H,2-3,20H2,1H3 |
| InChIKey | JHUINGFOHYBBSQ-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.81 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |