C15H13ClF3NS — CID 43331838
[5-[4-chloro-3-(trifluoromethyl)phenyl]thiophen-2-yl]-cyclopropylmethanamine (PubChem CID 43331838) has the molecular formula C15H13ClF3NS and a molecular weight of 331.79 g/mol. Its IUPAC name is [5-[4-chloro-3-(trifluoromethyl)phenyl]thiophen-2-yl]-cyclopropylmethanamine.
| Compound Name | [5-[4-chloro-3-(trifluoromethyl)phenyl]thiophen-2-yl]-cyclopropylmethanamine |
|---|---|
| PubChem CID | 43331838 |
| Molecular Formula | C15H13ClF3NS |
| Molecular Weight | 331.79 g/mol |
| Exact Mass | 331.04 |
| IUPAC Name | [5-[4-chloro-3-(trifluoromethyl)phenyl]thiophen-2-yl]-cyclopropylmethanamine |
| SMILES | NC(c1ccc(-c2ccc(Cl)c(C(F)(F)F)c2)s1)C1CC1 |
| InChI | InChI=1S/C15H13ClF3NS/c16-11-4-3-9(7-10(11)15(17,18)19)12-5-6-13(21-12)14(20)8-1-2-8/h3-8,14H,1-2,20H2 |
| InChIKey | QBQXHZSPJADTEB-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.79 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |