C10H5F5N2O2 — CID 115565016
4-(2,3,4,5,6-pentafluorophenyl)piperazine-2,6-dione (PubChem CID 115565016) has the molecular formula C10H5F5N2O2 and a molecular weight of 280.15 g/mol. Its IUPAC name is 4-(2,3,4,5,6-pentafluorophenyl)piperazine-2,6-dione.
| Compound Name | 4-(2,3,4,5,6-pentafluorophenyl)piperazine-2,6-dione |
|---|---|
| PubChem CID | 115565016 |
| Molecular Formula | C10H5F5N2O2 |
| Molecular Weight | 280.15 g/mol |
| Exact Mass | 280.03 |
| IUPAC Name | 4-(2,3,4,5,6-pentafluorophenyl)piperazine-2,6-dione |
| SMILES | O=C1CN(c2c(F)c(F)c(F)c(F)c2F)CC(=O)N1 |
| InChI | InChI=1S/C10H5F5N2O2/c11-5-6(12)8(14)10(9(15)7(5)13)17-1-3(18)16-4(19)2-17/h1-2H2,(H,16,18,19) |
| InChIKey | ZRZRBRCSXCUKCL-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.15 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|