C11H5F5N2O2S — CID 115565223
4-methyl-2-(2,3,4,5,6-pentafluoroanilino)-1,3-thiazole-5-carboxylic acid (PubChem CID 115565223) has the molecular formula C11H5F5N2O2S and a molecular weight of 324.23 g/mol. Its IUPAC name is 4-methyl-2-(2,3,4,5,6-pentafluoroanilino)-1,3-thiazole-5-carboxylic acid.
| Compound Name | 4-methyl-2-(2,3,4,5,6-pentafluoroanilino)-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 115565223 |
| Molecular Formula | C11H5F5N2O2S |
| Molecular Weight | 324.23 g/mol |
| Exact Mass | 324.00 |
| IUPAC Name | 4-methyl-2-(2,3,4,5,6-pentafluoroanilino)-1,3-thiazole-5-carboxylic acid |
| SMILES | Cc1nc(Nc2c(F)c(F)c(F)c(F)c2F)sc1C(=O)O |
| InChI | InChI=1S/C11H5F5N2O2S/c1-2-9(10(19)20)21-11(17-2)18-8-6(15)4(13)3(12)5(14)7(8)16/h1H3,(H,17,18)(H,19,20) |
| InChIKey | IGVHUKMVTVKJMC-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.23 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|