2-(carboxyoxyamino)-4-methyl-1,3-thiazole-5-carboxylic acid

C6H6N2O5S — CID 141096674

IUPAC2-(carboxyoxyamino)-4-methyl-1,3-thiazole-5-carboxylic acid
SMILESCc1nc(NOC(=O)O)sc1C(=O)O
InChIInChI=1S/C6H6N2O5S/c1-2-3(4(9)10)14-5(7-2)8-13-6(11)12/h1H3,(H,7,8)(H,9,10)(H,11,12)
InChIKeyGWYCHLSNZGPHAG-UHFFFAOYSA-N
MW218.19 g/mol
LogP1.17
Rot. Bonds3

About 2-(carboxyoxyamino)-4-methyl-1,3-thiazole-5-carboxylic acid

2-(carboxyoxyamino)-4-methyl-1,3-thiazole-5-carboxylic acid (PubChem CID 141096674) has the molecular formula C6H6N2O5S and a molecular weight of 218.19 g/mol. Its IUPAC name is 2-(carboxyoxyamino)-4-methyl-1,3-thiazole-5-carboxylic acid.

Molecular Properties

Compound Name2-(carboxyoxyamino)-4-methyl-1,3-thiazole-5-carboxylic acid
PubChem CID141096674
Molecular FormulaC6H6N2O5S
Molecular Weight218.19 g/mol
Exact Mass218.00
IUPAC Name2-(carboxyoxyamino)-4-methyl-1,3-thiazole-5-carboxylic acid
SMILESCc1nc(NOC(=O)O)sc1C(=O)O
InChIInChI=1S/C6H6N2O5S/c1-2-3(4(9)10)14-5(7-2)8-13-6(11)12/h1H3,(H,7,8)(H,9,10)(H,11,12)
InChIKeyGWYCHLSNZGPHAG-UHFFFAOYSA-N
XLogP1.17
TPSA108.75 Ų
H-Bond Donors3
H-Bond Acceptors6
Rotatable Bonds3
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500218.19
LogP ≤ 51.17
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 2-(carboxyoxyamino)-4-methyl-1,3-thiazole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(carboxyoxyamino)-4-methyl-1,3-thiazole-5-carboxylic acid?
The IUPAC name of 2-(carboxyoxyamino)-4-methyl-1,3-thiazole-5-carboxylic acid (CID 141096674) is 2-(carboxyoxyamino)-4-methyl-1,3-thiazole-5-carboxylic acid.
What is the SMILES notation for 2-(carboxyoxyamino)-4-methyl-1,3-thiazole-5-carboxylic acid?
The canonical SMILES for 2-(carboxyoxyamino)-4-methyl-1,3-thiazole-5-carboxylic acid is Cc1nc(NOC(=O)O)sc1C(=O)O.
What is the InChIKey of 2-(carboxyoxyamino)-4-methyl-1,3-thiazole-5-carboxylic acid?
The InChIKey is GWYCHLSNZGPHAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N2O5S/c1-2-3(4(9)10)14-5(7-2)8-13-6(11)12/h1H3,(H,7,8)(H,9,10)(H,11,12).
What are the key properties of 2-(carboxyoxyamino)-4-methyl-1,3-thiazole-5-carboxylic acid?
2-(carboxyoxyamino)-4-methyl-1,3-thiazole-5-carboxylic acid has a molecular weight of 218.19 g/mol, XLogP of 1.17, 3 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(carboxyoxyamino)-4-methyl-1,3-thiazole-5-carboxylic acid is sourced from PubChem (CID 141096674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).