C6H6N2O5S — CID 141096674
2-(carboxyoxyamino)-4-methyl-1,3-thiazole-5-carboxylic acid (PubChem CID 141096674) has the molecular formula C6H6N2O5S and a molecular weight of 218.19 g/mol. Its IUPAC name is 2-(carboxyoxyamino)-4-methyl-1,3-thiazole-5-carboxylic acid.
| Compound Name | 2-(carboxyoxyamino)-4-methyl-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 141096674 |
| Molecular Formula | C6H6N2O5S |
| Molecular Weight | 218.19 g/mol |
| Exact Mass | 218.00 |
| IUPAC Name | 2-(carboxyoxyamino)-4-methyl-1,3-thiazole-5-carboxylic acid |
| SMILES | Cc1nc(NOC(=O)O)sc1C(=O)O |
| InChI | InChI=1S/C6H6N2O5S/c1-2-3(4(9)10)14-5(7-2)8-13-6(11)12/h1H3,(H,7,8)(H,9,10)(H,11,12) |
| InChIKey | GWYCHLSNZGPHAG-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 108.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.19 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|