C10H13ClN2O4S — CID 54333856
tert-butyl [(5-carbonochloridoyl-4-methyl-1,3-thiazol-2-yl)amino] carbonate (PubChem CID 54333856) has the molecular formula C10H13ClN2O4S and a molecular weight of 292.74 g/mol. Its IUPAC name is tert-butyl [(5-carbonochloridoyl-4-methyl-1,3-thiazol-2-yl)amino] carbonate.
| Compound Name | tert-butyl [(5-carbonochloridoyl-4-methyl-1,3-thiazol-2-yl)amino] carbonate |
|---|---|
| PubChem CID | 54333856 |
| Molecular Formula | C10H13ClN2O4S |
| Molecular Weight | 292.74 g/mol |
| Exact Mass | 292.03 |
| IUPAC Name | tert-butyl [(5-carbonochloridoyl-4-methyl-1,3-thiazol-2-yl)amino] carbonate |
| SMILES | Cc1nc(NOC(=O)OC(C)(C)C)sc1C(=O)Cl |
| InChI | InChI=1S/C10H13ClN2O4S/c1-5-6(7(11)14)18-8(12-5)13-17-9(15)16-10(2,3)4/h1-4H3,(H,12,13) |
| InChIKey | TUBKRNXEDWXJCZ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.74 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|