2-(1,1-difluoroethyl)-4-methyl-1,3-thiazole-5-carboxylic acid

C7H7F2NO2S — CID 146589738

IUPAC2-(1,1-difluoroethyl)-4-methyl-1,3-thiazole-5-carboxylic acid
SMILESCc1nc(C(C)(F)F)sc1C(=O)O
InChIInChI=1S/C7H7F2NO2S/c1-3-4(5(11)12)13-6(10-3)7(2,8)9/h1-2H3,(H,11,12)
InChIKeyMCCCVOYRLGLHIJ-UHFFFAOYSA-N
MW207.20 g/mol
LogP2.26
Rot. Bonds2

About 2-(1,1-difluoroethyl)-4-methyl-1,3-thiazole-5-carboxylic acid

2-(1,1-difluoroethyl)-4-methyl-1,3-thiazole-5-carboxylic acid (PubChem CID 146589738) has the molecular formula C7H7F2NO2S and a molecular weight of 207.20 g/mol. Its IUPAC name is 2-(1,1-difluoroethyl)-4-methyl-1,3-thiazole-5-carboxylic acid.

Molecular Properties

Compound Name2-(1,1-difluoroethyl)-4-methyl-1,3-thiazole-5-carboxylic acid
PubChem CID146589738
Molecular FormulaC7H7F2NO2S
Molecular Weight207.20 g/mol
Exact Mass207.02
IUPAC Name2-(1,1-difluoroethyl)-4-methyl-1,3-thiazole-5-carboxylic acid
SMILESCc1nc(C(C)(F)F)sc1C(=O)O
InChIInChI=1S/C7H7F2NO2S/c1-3-4(5(11)12)13-6(10-3)7(2,8)9/h1-2H3,(H,11,12)
InChIKeyMCCCVOYRLGLHIJ-UHFFFAOYSA-N
XLogP2.26
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500207.20
LogP ≤ 52.26
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-(1,1-difluoroethyl)-4-methyl-1,3-thiazole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(1,1-difluoroethyl)-4-methyl-1,3-thiazole-5-carboxylic acid?
The IUPAC name of 2-(1,1-difluoroethyl)-4-methyl-1,3-thiazole-5-carboxylic acid (CID 146589738) is 2-(1,1-difluoroethyl)-4-methyl-1,3-thiazole-5-carboxylic acid.
What is the SMILES notation for 2-(1,1-difluoroethyl)-4-methyl-1,3-thiazole-5-carboxylic acid?
The canonical SMILES for 2-(1,1-difluoroethyl)-4-methyl-1,3-thiazole-5-carboxylic acid is Cc1nc(C(C)(F)F)sc1C(=O)O.
What is the InChIKey of 2-(1,1-difluoroethyl)-4-methyl-1,3-thiazole-5-carboxylic acid?
The InChIKey is MCCCVOYRLGLHIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7F2NO2S/c1-3-4(5(11)12)13-6(10-3)7(2,8)9/h1-2H3,(H,11,12).
What are the key properties of 2-(1,1-difluoroethyl)-4-methyl-1,3-thiazole-5-carboxylic acid?
2-(1,1-difluoroethyl)-4-methyl-1,3-thiazole-5-carboxylic acid has a molecular weight of 207.20 g/mol, XLogP of 2.26, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,1-difluoroethyl)-4-methyl-1,3-thiazole-5-carboxylic acid is sourced from PubChem (CID 146589738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).