C11H10BrClN2S — CID 115568091
1-[2-(3-bromo-4-chlorophenyl)-1,3-thiazol-4-yl]ethanamine (PubChem CID 115568091) has the molecular formula C11H10BrClN2S and a molecular weight of 317.64 g/mol. Its IUPAC name is 1-[2-(3-bromo-4-chlorophenyl)-1,3-thiazol-4-yl]ethanamine.
| Compound Name | 1-[2-(3-bromo-4-chlorophenyl)-1,3-thiazol-4-yl]ethanamine |
|---|---|
| PubChem CID | 115568091 |
| Molecular Formula | C11H10BrClN2S |
| Molecular Weight | 317.64 g/mol |
| Exact Mass | 315.94 |
| IUPAC Name | 1-[2-(3-bromo-4-chlorophenyl)-1,3-thiazol-4-yl]ethanamine |
| SMILES | CC(N)c1csc(-c2ccc(Cl)c(Br)c2)n1 |
| InChI | InChI=1S/C11H10BrClN2S/c1-6(14)10-5-16-11(15-10)7-2-3-9(13)8(12)4-7/h2-6H,14H2,1H3 |
| InChIKey | NILVCTGAISNGBS-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.64 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |