C15H17BrClN3 — CID 115568456
1-[2-(3-bromo-4-chlorophenyl)-6-methylpyrimidin-4-yl]butan-2-amine (PubChem CID 115568456) has the molecular formula C15H17BrClN3 and a molecular weight of 354.68 g/mol. Its IUPAC name is 1-[2-(3-bromo-4-chlorophenyl)-6-methylpyrimidin-4-yl]butan-2-amine.
| Compound Name | 1-[2-(3-bromo-4-chlorophenyl)-6-methylpyrimidin-4-yl]butan-2-amine |
|---|---|
| PubChem CID | 115568456 |
| Molecular Formula | C15H17BrClN3 |
| Molecular Weight | 354.68 g/mol |
| Exact Mass | 353.03 |
| IUPAC Name | 1-[2-(3-bromo-4-chlorophenyl)-6-methylpyrimidin-4-yl]butan-2-amine |
| SMILES | CCC(N)Cc1cc(C)nc(-c2ccc(Cl)c(Br)c2)n1 |
| InChI | InChI=1S/C15H17BrClN3/c1-3-11(18)8-12-6-9(2)19-15(20-12)10-4-5-14(17)13(16)7-10/h4-7,11H,3,8,18H2,1-2H3 |
| InChIKey | YVIAHXVVHZTKJH-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.68 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |