C8H13F3N2S — CID 115570989
N-methyl-3-(trifluoromethyl)piperidine-1-carbothioamide (PubChem CID 115570989) has the molecular formula C8H13F3N2S and a molecular weight of 226.27 g/mol. Its IUPAC name is N-methyl-3-(trifluoromethyl)piperidine-1-carbothioamide.
| Compound Name | N-methyl-3-(trifluoromethyl)piperidine-1-carbothioamide |
|---|---|
| PubChem CID | 115570989 |
| Molecular Formula | C8H13F3N2S |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | N-methyl-3-(trifluoromethyl)piperidine-1-carbothioamide |
| SMILES | CNC(=S)N1CCCC(C(F)(F)F)C1 |
| InChI | InChI=1S/C8H13F3N2S/c1-12-7(14)13-4-2-3-6(5-13)8(9,10)11/h6H,2-5H2,1H3,(H,12,14) |
| InChIKey | ADCJWVHKYVEVJF-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|