C9H15F3N2S — CID 115570990
N-ethyl-3-(trifluoromethyl)piperidine-1-carbothioamide (PubChem CID 115570990) has the molecular formula C9H15F3N2S and a molecular weight of 240.29 g/mol. Its IUPAC name is N-ethyl-3-(trifluoromethyl)piperidine-1-carbothioamide.
| Compound Name | N-ethyl-3-(trifluoromethyl)piperidine-1-carbothioamide |
|---|---|
| PubChem CID | 115570990 |
| Molecular Formula | C9H15F3N2S |
| Molecular Weight | 240.29 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | N-ethyl-3-(trifluoromethyl)piperidine-1-carbothioamide |
| SMILES | CCNC(=S)N1CCCC(C(F)(F)F)C1 |
| InChI | InChI=1S/C9H15F3N2S/c1-2-13-8(15)14-5-3-4-7(6-14)9(10,11)12/h7H,2-6H2,1H3,(H,13,15) |
| InChIKey | VPAFRQNEWOQMHG-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.29 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|