C12H17FN2S — CID 115571016
1-[(4-fluorophenyl)methyl]-1-methyl-3-propan-2-ylthiourea (PubChem CID 115571016) has the molecular formula C12H17FN2S and a molecular weight of 240.35 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl]-1-methyl-3-propan-2-ylthiourea.
| Compound Name | 1-[(4-fluorophenyl)methyl]-1-methyl-3-propan-2-ylthiourea |
|---|---|
| PubChem CID | 115571016 |
| Molecular Formula | C12H17FN2S |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl]-1-methyl-3-propan-2-ylthiourea |
| SMILES | CC(C)NC(=S)N(C)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C12H17FN2S/c1-9(2)14-12(16)15(3)8-10-4-6-11(13)7-5-10/h4-7,9H,8H2,1-3H3,(H,14,16) |
| InChIKey | JUSSGNGTOAQGMW-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|