C12H17BrN2S — CID 115589435
1-[(3-bromophenyl)methyl]-1-methyl-3-propan-2-ylthiourea (PubChem CID 115589435) has the molecular formula C12H17BrN2S and a molecular weight of 301.25 g/mol. Its IUPAC name is 1-[(3-bromophenyl)methyl]-1-methyl-3-propan-2-ylthiourea.
| Compound Name | 1-[(3-bromophenyl)methyl]-1-methyl-3-propan-2-ylthiourea |
|---|---|
| PubChem CID | 115589435 |
| Molecular Formula | C12H17BrN2S |
| Molecular Weight | 301.25 g/mol |
| Exact Mass | 300.03 |
| IUPAC Name | 1-[(3-bromophenyl)methyl]-1-methyl-3-propan-2-ylthiourea |
| SMILES | CC(C)NC(=S)N(C)Cc1cccc(Br)c1 |
| InChI | InChI=1S/C12H17BrN2S/c1-9(2)14-12(16)15(3)8-10-5-4-6-11(13)7-10/h4-7,9H,8H2,1-3H3,(H,14,16) |
| InChIKey | OWYFELMPXYTFHR-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.25 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|