C11H16BrNO — CID 61416066
1-[(3-bromophenyl)methyl-methylamino]propan-2-ol (PubChem CID 61416066) has the molecular formula C11H16BrNO and a molecular weight of 258.16 g/mol. Its IUPAC name is 1-[(3-bromophenyl)methyl-methylamino]propan-2-ol.
| Compound Name | 1-[(3-bromophenyl)methyl-methylamino]propan-2-ol |
|---|---|
| PubChem CID | 61416066 |
| Molecular Formula | C11H16BrNO |
| Molecular Weight | 258.16 g/mol |
| Exact Mass | 257.04 |
| IUPAC Name | 1-[(3-bromophenyl)methyl-methylamino]propan-2-ol |
| SMILES | CC(O)CN(C)Cc1cccc(Br)c1 |
| InChI | InChI=1S/C11H16BrNO/c1-9(14)7-13(2)8-10-4-3-5-11(12)6-10/h3-6,9,14H,7-8H2,1-2H3 |
| InChIKey | ZTAICBRNBFSMDK-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.16 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |