C20H36N2O4 — CID 22600659
1-[[3-[[bis(2-hydroxypropyl)amino]methyl]phenyl]methyl-(2-hydroxypropyl)amino]propan-2-ol (PubChem CID 22600659) has the molecular formula C20H36N2O4 and a molecular weight of 368.52 g/mol. Its IUPAC name is 1-[[3-[[bis(2-hydroxypropyl)amino]methyl]phenyl]methyl-(2-hydroxypropyl)amino]propan-2-ol.
| Compound Name | 1-[[3-[[bis(2-hydroxypropyl)amino]methyl]phenyl]methyl-(2-hydroxypropyl)amino]propan-2-ol |
|---|---|
| PubChem CID | 22600659 |
| Molecular Formula | C20H36N2O4 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.27 |
| IUPAC Name | 1-[[3-[[bis(2-hydroxypropyl)amino]methyl]phenyl]methyl-(2-hydroxypropyl)amino]propan-2-ol |
| SMILES | CC(O)CN(Cc1cccc(CN(CC(C)O)CC(C)O)c1)CC(C)O |
| InChI | InChI=1S/C20H36N2O4/c1-15(23)9-21(10-16(2)24)13-19-6-5-7-20(8-19)14-22(11-17(3)25)12-18(4)26/h5-8,15-18,23-26H,9-14H2,1-4H3 |
| InChIKey | TVELKUHYYAIZJR-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 87.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |