C18H22BrNO — CID 62617313
3-[(3-bromophenyl)methyl-methylamino]-2-methyl-1-phenylpropan-1-ol (PubChem CID 62617313) has the molecular formula C18H22BrNO and a molecular weight of 348.28 g/mol. Its IUPAC name is 3-[(3-bromophenyl)methyl-methylamino]-2-methyl-1-phenylpropan-1-ol.
| Compound Name | 3-[(3-bromophenyl)methyl-methylamino]-2-methyl-1-phenylpropan-1-ol |
|---|---|
| PubChem CID | 62617313 |
| Molecular Formula | C18H22BrNO |
| Molecular Weight | 348.28 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | 3-[(3-bromophenyl)methyl-methylamino]-2-methyl-1-phenylpropan-1-ol |
| SMILES | CC(CN(C)Cc1cccc(Br)c1)C(O)c1ccccc1 |
| InChI | InChI=1S/C18H22BrNO/c1-14(18(21)16-8-4-3-5-9-16)12-20(2)13-15-7-6-10-17(19)11-15/h3-11,14,18,21H,12-13H2,1-2H3 |
| InChIKey | TYOSMYKREFIBEU-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.28 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |