C18H21ClINO2 — CID 142099027
[2-chloro-4-[[[(2R,3R)-3-hydroxy-2-methyl-3-phenylpropyl]-methylamino]methyl]phenyl] hypoiodite (PubChem CID 142099027) has the molecular formula C18H21ClINO2 and a molecular weight of 445.73 g/mol. Its IUPAC name is [2-chloro-4-[[[(2R,3R)-3-hydroxy-2-methyl-3-phenylpropyl]-methylamino]methyl]phenyl] hypoiodite.
| Compound Name | [2-chloro-4-[[[(2R,3R)-3-hydroxy-2-methyl-3-phenylpropyl]-methylamino]methyl]phenyl] hypoiodite |
|---|---|
| PubChem CID | 142099027 |
| Molecular Formula | C18H21ClINO2 |
| Molecular Weight | 445.73 g/mol |
| Exact Mass | 445.03 |
| IUPAC Name | [2-chloro-4-[[[(2R,3R)-3-hydroxy-2-methyl-3-phenylpropyl]-methylamino]methyl]phenyl] hypoiodite |
| SMILES | C[C@H](CN(C)Cc1ccc(OI)c(Cl)c1)[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C18H21ClINO2/c1-13(18(22)15-6-4-3-5-7-15)11-21(2)12-14-8-9-17(23-20)16(19)10-14/h3-10,13,18,22H,11-12H2,1-2H3/t13-,18-/m1/s1 |
| InChIKey | OCONVZRMRSOMMP-FZKQIMNGSA-N |
| XLogP | 4.87 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.73 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|