C13H20BrN — CID 55136782
N-[(3-bromophenyl)methyl]-N,2-dimethylbutan-1-amine (PubChem CID 55136782) has the molecular formula C13H20BrN and a molecular weight of 270.21 g/mol. Its IUPAC name is N-[(3-bromophenyl)methyl]-N,2-dimethylbutan-1-amine.
| Compound Name | N-[(3-bromophenyl)methyl]-N,2-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 55136782 |
| Molecular Formula | C13H20BrN |
| Molecular Weight | 270.21 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | N-[(3-bromophenyl)methyl]-N,2-dimethylbutan-1-amine |
| SMILES | CCC(C)CN(C)Cc1cccc(Br)c1 |
| InChI | InChI=1S/C13H20BrN/c1-4-11(2)9-15(3)10-12-6-5-7-13(14)8-12/h5-8,11H,4,9-10H2,1-3H3 |
| InChIKey | VRGGULWOERKNIE-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.21 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |