C12H23N3S — CID 115571037
1-(1-azabicyclo[2.2.2]octan-3-yl)-3-(2-methylpropyl)thiourea (PubChem CID 115571037) has the molecular formula C12H23N3S and a molecular weight of 241.40 g/mol. Its IUPAC name is 1-(1-azabicyclo[2.2.2]octan-3-yl)-3-(2-methylpropyl)thiourea.
| Compound Name | 1-(1-azabicyclo[2.2.2]octan-3-yl)-3-(2-methylpropyl)thiourea |
|---|---|
| PubChem CID | 115571037 |
| Molecular Formula | C12H23N3S |
| Molecular Weight | 241.40 g/mol |
| Exact Mass | 241.16 |
| IUPAC Name | 1-(1-azabicyclo[2.2.2]octan-3-yl)-3-(2-methylpropyl)thiourea |
| SMILES | CC(C)CNC(=S)NC1CN2CCC1CC2 |
| InChI | InChI=1S/C12H23N3S/c1-9(2)7-13-12(16)14-11-8-15-5-3-10(11)4-6-15/h9-11H,3-8H2,1-2H3,(H2,13,14,16) |
| InChIKey | IJSSTIJGKMCWPD-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.40 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|