C10H22N4 — CID 115571090
2-(2,6-dimethylheptan-4-ylideneamino)guanidine (PubChem CID 115571090) has the molecular formula C10H22N4 and a molecular weight of 198.31 g/mol. Its IUPAC name is 2-(2,6-dimethylheptan-4-ylideneamino)guanidine.
| Compound Name | 2-(2,6-dimethylheptan-4-ylideneamino)guanidine |
|---|---|
| PubChem CID | 115571090 |
| Molecular Formula | C10H22N4 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.18 |
| IUPAC Name | 2-(2,6-dimethylheptan-4-ylideneamino)guanidine |
| SMILES | CC(C)CC(CC(C)C)=NN=C(N)N |
| InChI | InChI=1S/C10H22N4/c1-7(2)5-9(6-8(3)4)13-14-10(11)12/h7-8H,5-6H2,1-4H3,(H4,11,12,14) |
| InChIKey | RBWJXSKHLQLUAU-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 76.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|