C14H28N2 — CID 57239756
2,11-dimethyldodecane-4,9-diimine (PubChem CID 57239756) has the molecular formula C14H28N2 and a molecular weight of 224.39 g/mol. Its IUPAC name is 2,11-dimethyldodecane-4,9-diimine.
| Compound Name | 2,11-dimethyldodecane-4,9-diimine |
|---|---|
| PubChem CID | 57239756 |
| Molecular Formula | C14H28N2 |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.23 |
| IUPAC Name | 2,11-dimethyldodecane-4,9-diimine |
| SMILES | [H]/N=C(/CCCC/C(CC(C)C)=N\[H])CC(C)C |
| InChI | InChI=1S/C14H28N2/c1-11(2)9-13(15)7-5-6-8-14(16)10-12(3)4/h11-12,15-16H,5-10H2,1-4H3/b15-13-,16-14+ |
| InChIKey | KRWSRZVRFLHBQZ-VCFJNTAESA-N |
| XLogP | 4.68 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|