C11H23N — CID 54163298
4-ethyl-2,2-dimethylheptan-3-imine (PubChem CID 54163298) has the molecular formula C11H23N and a molecular weight of 169.31 g/mol. Its IUPAC name is 4-ethyl-2,2-dimethylheptan-3-imine.
| Compound Name | 4-ethyl-2,2-dimethylheptan-3-imine |
|---|---|
| PubChem CID | 54163298 |
| Molecular Formula | C11H23N |
| Molecular Weight | 169.31 g/mol |
| Exact Mass | 169.18 |
| IUPAC Name | 4-ethyl-2,2-dimethylheptan-3-imine |
| SMILES | [H]/N=C(\C(CC)CCC)C(C)(C)C |
| InChI | InChI=1S/C11H23N/c1-6-8-9(7-2)10(12)11(3,4)5/h9,12H,6-8H2,1-5H3/b12-10+ |
| InChIKey | OPXLOULINPAZOP-ZRDIBKRKSA-N |
| XLogP | 3.88 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.31 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|