C8H15N — CID 135012155
(3R)-2,2,3-trimethylcyclopentan-1-imine (PubChem CID 135012155) has the molecular formula C8H15N and a molecular weight of 125.21 g/mol. Its IUPAC name is (3R)-2,2,3-trimethylcyclopentan-1-imine.
| Compound Name | (3R)-2,2,3-trimethylcyclopentan-1-imine |
|---|---|
| PubChem CID | 135012155 |
| Molecular Formula | C8H15N |
| Molecular Weight | 125.21 g/mol |
| Exact Mass | 125.12 |
| IUPAC Name | (3R)-2,2,3-trimethylcyclopentan-1-imine |
| SMILES | [H]/N=C1\CC[C@@H](C)C1(C)C |
| InChI | InChI=1S/C8H15N/c1-6-4-5-7(9)8(6,2)3/h6,9H,4-5H2,1-3H3/b9-7+/t6-/m1/s1 |
| InChIKey | VEEZIFGQHXGPNI-LPWOPMKCSA-N |
| XLogP | 2.46 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 125.21 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|