C14H29N — CID 91180301
2,7,8,8-tetramethyldecan-4-imine (PubChem CID 91180301) has the molecular formula C14H29N and a molecular weight of 211.39 g/mol. Its IUPAC name is 2,7,8,8-tetramethyldecan-4-imine.
| Compound Name | 2,7,8,8-tetramethyldecan-4-imine |
|---|---|
| PubChem CID | 91180301 |
| Molecular Formula | C14H29N |
| Molecular Weight | 211.39 g/mol |
| Exact Mass | 211.23 |
| IUPAC Name | 2,7,8,8-tetramethyldecan-4-imine |
| SMILES | [H]/N=C(/CCC(C)C(C)(C)CC)CC(C)C |
| InChI | InChI=1S/C14H29N/c1-7-14(5,6)12(4)8-9-13(15)10-11(2)3/h11-12,15H,7-10H2,1-6H3/b15-13- |
| InChIKey | SSKQQBPQVSYHQG-SQFISAMPSA-N |
| XLogP | 4.90 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.39 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|