C12H23N — CID 20692070
1-(1,3,3,5-tetramethylcyclohexyl)ethanimine (PubChem CID 20692070) has the molecular formula C12H23N and a molecular weight of 181.32 g/mol. Its IUPAC name is 1-(1,3,3,5-tetramethylcyclohexyl)ethanimine.
| Compound Name | 1-(1,3,3,5-tetramethylcyclohexyl)ethanimine |
|---|---|
| PubChem CID | 20692070 |
| Molecular Formula | C12H23N |
| Molecular Weight | 181.32 g/mol |
| Exact Mass | 181.18 |
| IUPAC Name | 1-(1,3,3,5-tetramethylcyclohexyl)ethanimine |
| SMILES | [H]/N=C(\C)C1(C)CC(C)CC(C)(C)C1 |
| InChI | InChI=1S/C12H23N/c1-9-6-11(3,4)8-12(5,7-9)10(2)13/h9,13H,6-8H2,1-5H3/b13-10+ |
| InChIKey | HAVSCVAKZYAARK-JLHYYAGUSA-N |
| XLogP | 3.88 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.32 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|