C9H12N2O3 — CID 11557464
6-hydroxy-1,3-dimethyl-5-prop-2-enylpyrimidine-2,4-dione (PubChem CID 11557464) has the molecular formula C9H12N2O3 and a molecular weight of 196.21 g/mol. Its IUPAC name is 6-hydroxy-1,3-dimethyl-5-prop-2-enylpyrimidine-2,4-dione.
| Compound Name | 6-hydroxy-1,3-dimethyl-5-prop-2-enylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 11557464 |
| Molecular Formula | C9H12N2O3 |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.08 |
| IUPAC Name | 6-hydroxy-1,3-dimethyl-5-prop-2-enylpyrimidine-2,4-dione |
| SMILES | C=CCc1c(O)n(C)c(=O)n(C)c1=O |
| InChI | InChI=1S/C9H12N2O3/c1-4-5-6-7(12)10(2)9(14)11(3)8(6)13/h4,12H,1,5H2,2-3H3 |
| InChIKey | WWVRHXMSOBXSIF-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 64.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|