C16H14F2N2O — CID 115576479
1-[(3,4-difluorophenyl)methyl]-3-ethylbenzimidazol-2-one (PubChem CID 115576479) has the molecular formula C16H14F2N2O and a molecular weight of 288.30 g/mol. Its IUPAC name is 1-[(3,4-difluorophenyl)methyl]-3-ethylbenzimidazol-2-one.
| Compound Name | 1-[(3,4-difluorophenyl)methyl]-3-ethylbenzimidazol-2-one |
|---|---|
| PubChem CID | 115576479 |
| Molecular Formula | C16H14F2N2O |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | 1-[(3,4-difluorophenyl)methyl]-3-ethylbenzimidazol-2-one |
| SMILES | CCn1c(=O)n(Cc2ccc(F)c(F)c2)c2ccccc21 |
| InChI | InChI=1S/C16H14F2N2O/c1-2-19-14-5-3-4-6-15(14)20(16(19)21)10-11-7-8-12(17)13(18)9-11/h3-9H,2,10H2,1H3 |
| InChIKey | QBDGREVGMPTQLG-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 26.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |