C23H17F2NO2 — CID 142438213
1-[(3,4-difluorophenyl)methyl]-3-methoxy-4-phenylquinolin-2-one (PubChem CID 142438213) has the molecular formula C23H17F2NO2 and a molecular weight of 377.39 g/mol. Its IUPAC name is 1-[(3,4-difluorophenyl)methyl]-3-methoxy-4-phenylquinolin-2-one.
| Compound Name | 1-[(3,4-difluorophenyl)methyl]-3-methoxy-4-phenylquinolin-2-one |
|---|---|
| PubChem CID | 142438213 |
| Molecular Formula | C23H17F2NO2 |
| Molecular Weight | 377.39 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | 1-[(3,4-difluorophenyl)methyl]-3-methoxy-4-phenylquinolin-2-one |
| SMILES | COc1c(-c2ccccc2)c2ccccc2n(Cc2ccc(F)c(F)c2)c1=O |
| InChI | InChI=1S/C23H17F2NO2/c1-28-22-21(16-7-3-2-4-8-16)17-9-5-6-10-20(17)26(23(22)27)14-15-11-12-18(24)19(25)13-15/h2-13H,14H2,1H3 |
| InChIKey | RKGSGBLOOSRFMD-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.39 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |