C10H12F2N2O2 — CID 11557671
6-(1,1-difluorobut-3-enyl)-3-ethyl-1H-pyrimidine-2,4-dione (PubChem CID 11557671) has the molecular formula C10H12F2N2O2 and a molecular weight of 230.21 g/mol. Its IUPAC name is 6-(1,1-difluorobut-3-enyl)-3-ethyl-1H-pyrimidine-2,4-dione.
| Compound Name | 6-(1,1-difluorobut-3-enyl)-3-ethyl-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 11557671 |
| Molecular Formula | C10H12F2N2O2 |
| Molecular Weight | 230.21 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | 6-(1,1-difluorobut-3-enyl)-3-ethyl-1H-pyrimidine-2,4-dione |
| SMILES | C=CCC(F)(F)c1cc(=O)n(CC)c(=O)[nH]1 |
| InChI | InChI=1S/C10H12F2N2O2/c1-3-5-10(11,12)7-6-8(15)14(4-2)9(16)13-7/h3,6H,1,4-5H2,2H3,(H,13,16) |
| InChIKey | ZLIQCPPPNNZDJD-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.21 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|