C12H24N2O3 — CID 115578688
N,N-bis(2-methoxyethyl)piperidine-1-carboxamide (PubChem CID 115578688) has the molecular formula C12H24N2O3 and a molecular weight of 244.33 g/mol. Its IUPAC name is N,N-bis(2-methoxyethyl)piperidine-1-carboxamide.
| Compound Name | N,N-bis(2-methoxyethyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 115578688 |
| Molecular Formula | C12H24N2O3 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.18 |
| IUPAC Name | N,N-bis(2-methoxyethyl)piperidine-1-carboxamide |
| SMILES | COCCN(CCOC)C(=O)N1CCCCC1 |
| InChI | InChI=1S/C12H24N2O3/c1-16-10-8-14(9-11-17-2)12(15)13-6-4-3-5-7-13/h3-11H2,1-2H3 |
| InChIKey | JIGXMAUNUYYKPU-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |