C12H23N3O4 — CID 61447579
2-[4-[ethyl(2-methoxyethyl)carbamoyl]piperazin-1-yl]acetic acid (PubChem CID 61447579) has the molecular formula C12H23N3O4 and a molecular weight of 273.33 g/mol. Its IUPAC name is 2-[4-[ethyl(2-methoxyethyl)carbamoyl]piperazin-1-yl]acetic acid.
| Compound Name | 2-[4-[ethyl(2-methoxyethyl)carbamoyl]piperazin-1-yl]acetic acid |
|---|---|
| PubChem CID | 61447579 |
| Molecular Formula | C12H23N3O4 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | 2-[4-[ethyl(2-methoxyethyl)carbamoyl]piperazin-1-yl]acetic acid |
| SMILES | CCN(CCOC)C(=O)N1CCN(CC(=O)O)CC1 |
| InChI | InChI=1S/C12H23N3O4/c1-3-14(8-9-19-2)12(18)15-6-4-13(5-7-15)10-11(16)17/h3-10H2,1-2H3,(H,16,17) |
| InChIKey | GHGLHOJIGGNWEC-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |