C14H27N3O4 — CID 63691291
2-[4-[2-ethoxyethyl(ethyl)carbamoyl]-1,4-diazepan-1-yl]acetic acid (PubChem CID 63691291) has the molecular formula C14H27N3O4 and a molecular weight of 301.39 g/mol. Its IUPAC name is 2-[4-[2-ethoxyethyl(ethyl)carbamoyl]-1,4-diazepan-1-yl]acetic acid.
| Compound Name | 2-[4-[2-ethoxyethyl(ethyl)carbamoyl]-1,4-diazepan-1-yl]acetic acid |
|---|---|
| PubChem CID | 63691291 |
| Molecular Formula | C14H27N3O4 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.20 |
| IUPAC Name | 2-[4-[2-ethoxyethyl(ethyl)carbamoyl]-1,4-diazepan-1-yl]acetic acid |
| SMILES | CCOCCN(CC)C(=O)N1CCCN(CC(=O)O)CC1 |
| InChI | InChI=1S/C14H27N3O4/c1-3-16(10-11-21-4-2)14(20)17-7-5-6-15(8-9-17)12-13(18)19/h3-12H2,1-2H3,(H,18,19) |
| InChIKey | BGDZDRDLOFANRQ-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|