C9H10N4O2 — CID 115580749
N-(2-cyanoethyl)-2-(2-oxopyrimidin-1-yl)acetamide (PubChem CID 115580749) has the molecular formula C9H10N4O2 and a molecular weight of 206.20 g/mol. Its IUPAC name is N-(2-cyanoethyl)-2-(2-oxopyrimidin-1-yl)acetamide.
| Compound Name | N-(2-cyanoethyl)-2-(2-oxopyrimidin-1-yl)acetamide |
|---|---|
| PubChem CID | 115580749 |
| Molecular Formula | C9H10N4O2 |
| Molecular Weight | 206.20 g/mol |
| Exact Mass | 206.08 |
| IUPAC Name | N-(2-cyanoethyl)-2-(2-oxopyrimidin-1-yl)acetamide |
| SMILES | N#CCCNC(=O)Cn1cccnc1=O |
| InChI | InChI=1S/C9H10N4O2/c10-3-1-4-11-8(14)7-13-6-2-5-12-9(13)15/h2,5-6H,1,4,7H2,(H,11,14) |
| InChIKey | BVCCXXOJONPDID-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 87.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.20 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|